C16H23N3O3S2 — CID 7738973
2-[3-(3-ethoxypropyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-methylacetamide (PubChem CID 7738973) has the molecular formula C16H23N3O3S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[3-(3-ethoxypropyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[3-(3-ethoxypropyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 7738973 |
| Molecular Formula | C16H23N3O3S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[3-(3-ethoxypropyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CCOCCCn1c(SCC(=O)NC)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C16H23N3O3S2/c1-5-22-8-6-7-19-15(21)13-10(2)11(3)24-14(13)18-16(19)23-9-12(20)17-4/h5-9H2,1-4H3,(H,17,20) |
| InChIKey | CXZSQPIVDGPQSG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|