C20H23ClN2O2S2 — CID 7359984
2-[(3-chlorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7359984) has the molecular formula C20H23ClN2O2S2 and a molecular weight of 423.00 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7359984 |
| Molecular Formula | C20H23ClN2O2S2 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOCCCn1c(SCc2cccc(Cl)c2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C20H23ClN2O2S2/c1-4-25-10-6-9-23-19(24)17-13(2)14(3)27-18(17)22-20(23)26-12-15-7-5-8-16(21)11-15/h5,7-8,11H,4,6,9-10,12H2,1-3H3 |
| InChIKey | XFNCVQCTWWZBGT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|