C20H21ClN2O2S — CID 55357472
2-benzylsulfanyl-7-chloro-3-(3-ethoxypropyl)quinazolin-4-one (PubChem CID 55357472) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-chloro-3-(3-ethoxypropyl)quinazolin-4-one.
| Compound Name | 2-benzylsulfanyl-7-chloro-3-(3-ethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 55357472 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-benzylsulfanyl-7-chloro-3-(3-ethoxypropyl)quinazolin-4-one |
| SMILES | CCOCCCn1c(SCc2ccccc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-25-12-6-11-23-19(24)17-10-9-16(21)13-18(17)22-20(23)26-14-15-7-4-3-5-8-15/h3-5,7-10,13H,2,6,11-12,14H2,1H3 |
| InChIKey | PEJRTFJOGRKPSF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|