C20H20F2N2O2S — CID 51365613
2-[(2,4-difluorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one (PubChem CID 51365613) has the molecular formula C20H20F2N2O2S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one.
| Compound Name | 2-[(2,4-difluorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 51365613 |
| Molecular Formula | C20H20F2N2O2S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methylsulfanyl]-3-(3-ethoxypropyl)quinazolin-4-one |
| SMILES | CCOCCCn1c(SCc2ccc(F)cc2F)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H20F2N2O2S/c1-2-26-11-5-10-24-19(25)16-6-3-4-7-18(16)23-20(24)27-13-14-8-9-15(21)12-17(14)22/h3-4,6-9,12H,2,5,10-11,13H2,1H3 |
| InChIKey | DXLILVWXLWYVOO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|