C22H25FN2O3S — CID 7738228
2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 7738228) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7738228 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | COc1ccc(CSc2nc3ccccc3c(=O)n2CCCOC(C)C)cc1F |
| InChI | InChI=1S/C22H25FN2O3S/c1-15(2)28-12-6-11-25-21(26)17-7-4-5-8-19(17)24-22(25)29-14-16-9-10-20(27-3)18(23)13-16/h4-5,7-10,13,15H,6,11-12,14H2,1-3H3 |
| InChIKey | SJELBNLZMCEJOC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|