C25H24N2O3S — CID 41078081
2-benzylsulfanyl-3-[2-(3,4-dimethoxyphenyl)ethyl]quinazolin-4-one (PubChem CID 41078081) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-benzylsulfanyl-3-[2-(3,4-dimethoxyphenyl)ethyl]quinazolin-4-one.
| Compound Name | 2-benzylsulfanyl-3-[2-(3,4-dimethoxyphenyl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 41078081 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-benzylsulfanyl-3-[2-(3,4-dimethoxyphenyl)ethyl]quinazolin-4-one |
| SMILES | COc1ccc(CCn2c(SCc3ccccc3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C25H24N2O3S/c1-29-22-13-12-18(16-23(22)30-2)14-15-27-24(28)20-10-6-7-11-21(20)26-25(27)31-17-19-8-4-3-5-9-19/h3-13,16H,14-15,17H2,1-2H3 |
| InChIKey | NSENBLJXBSTJAY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |