C24H22N4O5S — CID 46259888
3-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 46259888) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46259888 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(CCn2c(SCc3cccc([N+](=O)[O-])c3)nc3ncccc3c2=O)cc1OC |
| InChI | InChI=1S/C24H22N4O5S/c1-32-20-9-8-16(14-21(20)33-2)10-12-27-23(29)19-7-4-11-25-22(19)26-24(27)34-15-17-5-3-6-18(13-17)28(30)31/h3-9,11,13-14H,10,12,15H2,1-2H3 |
| InChIKey | ORPQLMCKENPVPP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|