C13H9N3O3S — CID 46341180
2-[(3-nitrophenyl)methylsulfanyl]-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 46341180) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylsulfanyl]-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-[(3-nitrophenyl)methylsulfanyl]-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 46341180 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[(3-nitrophenyl)methylsulfanyl]-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1cccc(CSc2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C13H9N3O3S/c17-16(18)10-4-1-3-9(7-10)8-20-13-15-12-11(19-13)5-2-6-14-12/h1-7H,8H2 |
| InChIKey | UOTZGDYUZZUPHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|