C15H11N5O4S — CID 10594491
N-[(E)-(4-nitrophenyl)methylideneamino]-2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetamide (PubChem CID 10594491) has the molecular formula C15H11N5O4S and a molecular weight of 357.35 g/mol. Its IUPAC name is N-[(E)-(4-nitrophenyl)methylideneamino]-2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetamide.
| Compound Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 10594491 |
| Molecular Formula | C15H11N5O4S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nc2ncccc2o1)N/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N5O4S/c21-13(9-25-15-18-14-12(24-15)2-1-7-16-14)19-17-8-10-3-5-11(6-4-10)20(22)23/h1-8H,9H2,(H,19,21)/b17-8+ |
| InChIKey | CQLGGSBDOYJZOZ-CAOOACKPSA-N |
| XLogP | 2.37 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|