C12H12N6O3S — CID 5422706
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 5422706) has the molecular formula C12H12N6O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5422706 |
| Molecular Formula | C12H12N6O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cn1cnnc1SCC(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N6O3S/c1-17-8-14-16-12(17)22-7-11(19)15-13-6-9-2-4-10(5-3-9)18(20)21/h2-6,8H,7H2,1H3,(H,15,19)/b13-6- |
| InChIKey | UVLXPEMPRCDHJS-MLPAPPSSSA-N |
| XLogP | 0.97 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|