C17H17N3O3S2 — CID 3990726
N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 3990726) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 3990726 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | CSc1ccc(C=NNC(=O)CSCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-24-16-8-4-13(5-9-16)10-18-19-17(21)12-25-11-14-2-6-15(7-3-14)20(22)23/h2-10H,11-12H2,1H3,(H,19,21) |
| InChIKey | ZJRLRKKCSTUTBQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|