C23H23BrN4O3S — CID 92663353
N-[(Z)-[4-bromo-2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 92663353) has the molecular formula C23H23BrN4O3S and a molecular weight of 515.43 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92663353 |
| Molecular Formula | C23H23BrN4O3S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(C)c(Br)c(/C=N\NC(=O)CSCc3ccc([N+](=O)[O-])cc3)c2C)cc1 |
| InChI | InChI=1S/C23H23BrN4O3S/c1-15-4-8-19(9-5-15)27-16(2)21(23(24)17(27)3)12-25-26-22(29)14-32-13-18-6-10-20(11-7-18)28(30)31/h4-12H,13-14H2,1-3H3,(H,26,29)/b25-12- |
| InChIKey | BKUJRRNCLYWAGE-ROTLSHHCSA-N |
| XLogP | 5.46 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|