C20H19ClN5O3S+ — CID 135442364
N-[(5-chloro-3-methyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 135442364) has the molecular formula C20H19ClN5O3S+ and a molecular weight of 444.92 g/mol. Its IUPAC name is N-[(5-chloro-3-methyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(5-chloro-3-methyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 135442364 |
| Molecular Formula | C20H19ClN5O3S+ |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-[(5-chloro-3-methyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1c(C=NNC(=O)CSCc2ccc([N+](=O)[O-])cc2)c(Cl)[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C20H18ClN5O3S/c1-14-18(20(21)24-25(14)16-5-3-2-4-6-16)11-22-23-19(27)13-30-12-15-7-9-17(10-8-15)26(28)29/h2-11H,12-13H2,1H3,(H,23,27)/p+1 |
| InChIKey | FMBMHMMDMOFJFW-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|