C27H23BrN4O3 — CID 19061405
2-(4-bromophenyl)-N-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 19061405) has the molecular formula C27H23BrN4O3 and a molecular weight of 531.41 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19061405 |
| Molecular Formula | C27H23BrN4O3 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)Cc2ccc(Br)cc2)c(C)n1-c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H23BrN4O3/c1-18-15-23(17-29-30-27(33)16-20-3-9-24(28)10-4-20)19(2)31(18)25-11-5-21(6-12-25)22-7-13-26(14-8-22)32(34)35/h3-15,17H,16H2,1-2H3,(H,30,33)/b29-17- |
| InChIKey | UWBWHAPVYCTHAN-RHANQZHGSA-N |
| XLogP | 6.12 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|