C24H26BrN3O — CID 126366967
N-[(E)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 126366967) has the molecular formula C24H26BrN3O and a molecular weight of 452.40 g/mol. Its IUPAC name is N-[(E)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(E)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126366967 |
| Molecular Formula | C24H26BrN3O |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[(E)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(CC(=O)N/N=C/c2cc(C)n(-c3ccc(C)c(Br)c3)c2C)cc1 |
| InChI | InChI=1S/C24H26BrN3O/c1-5-19-7-9-20(10-8-19)13-24(29)27-26-15-21-12-17(3)28(18(21)4)22-11-6-16(2)23(25)14-22/h6-12,14-15H,5,13H2,1-4H3,(H,27,29)/b26-15+ |
| InChIKey | FIYYRTUFXWDXBM-CVKSISIWSA-N |
| XLogP | 5.42 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|