C22H29BrN4O — CID 126384417
N-[(Z)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(cyclohexylamino)acetamide (PubChem CID 126384417) has the molecular formula C22H29BrN4O and a molecular weight of 445.41 g/mol. Its IUPAC name is N-[(Z)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(cyclohexylamino)acetamide.
| Compound Name | N-[(Z)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(cyclohexylamino)acetamide |
|---|---|
| PubChem CID | 126384417 |
| Molecular Formula | C22H29BrN4O |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[(Z)-[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(cyclohexylamino)acetamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N\NC(=O)CNC3CCCCC3)c2C)cc1Br |
| InChI | InChI=1S/C22H29BrN4O/c1-15-9-10-20(12-21(15)23)27-16(2)11-18(17(27)3)13-25-26-22(28)14-24-19-7-5-4-6-8-19/h9-13,19,24H,4-8,14H2,1-3H3,(H,26,28)/b25-13- |
| InChIKey | ZZJGMNJHVWVCKS-MXAYSNPKSA-N |
| XLogP | 4.54 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|