C26H30BrN3O — CID 3937607
N-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-tert-butylphenyl)acetamide (PubChem CID 3937607) has the molecular formula C26H30BrN3O and a molecular weight of 480.45 g/mol. Its IUPAC name is N-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-tert-butylphenyl)acetamide.
| Compound Name | N-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-tert-butylphenyl)acetamide |
|---|---|
| PubChem CID | 3937607 |
| Molecular Formula | C26H30BrN3O |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-tert-butylphenyl)acetamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=NNC(=O)Cc3ccc(C(C)(C)C)cc3)c2C)cc1Br |
| InChI | InChI=1S/C26H30BrN3O/c1-17-7-12-23(15-24(17)27)30-18(2)13-21(19(30)3)16-28-29-25(31)14-20-8-10-22(11-9-20)26(4,5)6/h7-13,15-16H,14H2,1-6H3,(H,29,31) |
| InChIKey | ZCOJDVYBUVKGQD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|