C21H20IN3O — CID 126005475
N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide (PubChem CID 126005475) has the molecular formula C21H20IN3O and a molecular weight of 457.32 g/mol. Its IUPAC name is N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126005475 |
| Molecular Formula | C21H20IN3O |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[(Z)-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide |
| SMILES | Cc1cc(/C=N\NC(=O)Cc2ccccc2)c(C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C21H20IN3O/c1-15-12-18(16(2)25(15)20-10-8-19(22)9-11-20)14-23-24-21(26)13-17-6-4-3-5-7-17/h3-12,14H,13H2,1-2H3,(H,24,26)/b23-14- |
| InChIKey | VEMXVFWDXUNNQK-UCQKPKSFSA-N |
| XLogP | 4.39 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|