C27H23N5O6 — CID 126002192
N-[(E)-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide (PubChem CID 126002192) has the molecular formula C27H23N5O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is N-[(E)-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(E)-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126002192 |
| Molecular Formula | C27H23N5O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[(E)-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylacetamide |
| SMILES | Cc1cc(/C=N/NC(=O)Cc2ccccc2)c(C)n1-c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H23N5O6/c1-18-14-21(17-28-29-27(33)15-20-6-4-3-5-7-20)19(2)30(18)22-8-11-24(12-9-22)38-26-13-10-23(31(34)35)16-25(26)32(36)37/h3-14,16-17H,15H2,1-2H3,(H,29,33)/b28-17+ |
| InChIKey | BBXYEKZMWHIDFQ-OGLMXYFKSA-N |
| XLogP | 5.40 |
| TPSA | 141.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|