C28H20FN5O6 — CID 3305629
2-cyano-3-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 3305629) has the molecular formula C28H20FN5O6 and a molecular weight of 541.50 g/mol. Its IUPAC name is 2-cyano-3-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3305629 |
| Molecular Formula | C28H20FN5O6 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 2-cyano-3-[1-[4-(2,4-dinitrophenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2ccccc2F)c(C)n1-c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H20FN5O6/c1-17-13-19(14-20(16-30)28(35)31-25-6-4-3-5-24(25)29)18(2)32(17)21-7-10-23(11-8-21)40-27-12-9-22(33(36)37)15-26(27)34(38)39/h3-15H,1-2H3,(H,31,35) |
| InChIKey | LTKZCKJEIJOXFU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|