C24H22FN3O — CID 3871464
2-cyano-3-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 3871464) has the molecular formula C24H22FN3O and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-cyano-3-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3871464 |
| Molecular Formula | C24H22FN3O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-cyano-3-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCc1ccccc1-n1c(C)cc(C=C(C#N)C(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C24H22FN3O/c1-4-18-9-5-8-12-23(18)28-16(2)13-19(17(28)3)14-20(15-26)24(29)27-22-11-7-6-10-21(22)25/h5-14H,4H2,1-3H3,(H,27,29) |
| InChIKey | KXLZEWFOXREIQA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|