C22H16Cl2FN3O — CID 6042169
(E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 6042169) has the molecular formula C22H16Cl2FN3O and a molecular weight of 428.29 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6042169 |
| Molecular Formula | C22H16Cl2FN3O |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccccc2F)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H16Cl2FN3O/c1-13-10-15(14(2)28(13)20-9-5-6-17(23)21(20)24)11-16(12-26)22(29)27-19-8-4-3-7-18(19)25/h3-11H,1-2H3,(H,27,29)/b16-11+ |
| InChIKey | XJONZEZRJKNTBQ-LFIBNONCSA-N |
| XLogP | 6.09 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|