C26H26ClN3O — CID 92989011
(Z)-3-[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 92989011) has the molecular formula C26H26ClN3O and a molecular weight of 431.97 g/mol. Its IUPAC name is (Z)-3-[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 92989011 |
| Molecular Formula | C26H26ClN3O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (Z)-3-[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2ccccc2Cl)c(C)n1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H26ClN3O/c1-17-14-19(15-20(16-28)25(31)29-24-9-7-6-8-23(24)27)18(2)30(17)22-12-10-21(11-13-22)26(3,4)5/h6-15H,1-5H3,(H,29,31)/b20-15- |
| InChIKey | ZGCYWHMYAHXQBX-HKWRFOASSA-N |
| XLogP | 6.59 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|