C22H16Br2ClN3O — CID 124531953
(Z)-3-[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 124531953) has the molecular formula C22H16Br2ClN3O and a molecular weight of 533.65 g/mol. Its IUPAC name is (Z)-3-[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 124531953 |
| Molecular Formula | C22H16Br2ClN3O |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 530.93 |
| IUPAC Name | (Z)-3-[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Br)c(/C=C(/C#N)C(=O)Nc2ccccc2Cl)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16Br2ClN3O/c1-13-18(21(24)14(2)28(13)17-9-7-16(23)8-10-17)11-15(12-26)22(29)27-20-6-4-3-5-19(20)25/h3-11H,1-2H3,(H,27,29)/b15-11- |
| InChIKey | QBNFSXXRAPPUPL-PTNGSMBKSA-N |
| XLogP | 6.82 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|