C26H19BrClN3O — CID 17276328
(E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 17276328) has the molecular formula C26H19BrClN3O and a molecular weight of 504.82 g/mol. Its IUPAC name is (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 17276328 |
| Molecular Formula | C26H19BrClN3O |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C/c1cn(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H19BrClN3O/c1-17-23(28)6-4-7-24(17)30-26(32)19(14-29)13-20-16-31(25-8-3-2-5-22(20)25)15-18-9-11-21(27)12-10-18/h2-13,16H,15H2,1H3,(H,30,32)/b19-13+ |
| InChIKey | RIIVLKKPNMNMKI-CPNJWEJPSA-N |
| XLogP | 6.96 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|