C19H17BrClN3O — CID 108823856
(Z)-3-[2-(4-bromophenyl)ethylamino]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 108823856) has the molecular formula C19H17BrClN3O and a molecular weight of 418.72 g/mol. Its IUPAC name is (Z)-3-[2-(4-bromophenyl)ethylamino]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[2-(4-bromophenyl)ethylamino]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108823856 |
| Molecular Formula | C19H17BrClN3O |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | (Z)-3-[2-(4-bromophenyl)ethylamino]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C\NCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrClN3O/c1-13-17(21)3-2-4-18(13)24-19(25)15(11-22)12-23-10-9-14-5-7-16(20)8-6-14/h2-8,12,23H,9-10H2,1H3,(H,24,25)/b15-12- |
| InChIKey | KEEYRRCBUBCGDK-QINSGFPZSA-N |
| XLogP | 4.59 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|