C20H18ClN3O3 — CID 108823834
methyl 4-[[[(Z)-3-(3-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate (PubChem CID 108823834) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is methyl 4-[[[(Z)-3-(3-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(Z)-3-(3-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 108823834 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | methyl 4-[[[(Z)-3-(3-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN/C=C(/C#N)C(=O)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-13-17(21)4-3-5-18(13)24-19(25)16(10-22)12-23-11-14-6-8-15(9-7-14)20(26)27-2/h3-9,12,23H,11H2,1-2H3,(H,24,25)/b16-12- |
| InChIKey | SZGWRQHADFGEND-VBKFSLOCSA-N |
| XLogP | 3.57 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|