C21H21N3O4 — CID 108855800
methyl 4-[[[(Z)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]amino]methyl]benzoate (PubChem CID 108855800) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl 4-[[[(Z)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(Z)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 108855800 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 4-[[[(Z)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]amino]methyl]benzoate |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C\NCc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-28-19-10-8-18(9-11-19)24-20(25)17(12-22)14-23-13-15-4-6-16(7-5-15)21(26)27-2/h4-11,14,23H,3,13H2,1-2H3,(H,24,25)/b17-14- |
| InChIKey | KQIFYZVZODKXMA-VKAVYKQESA-N |
| XLogP | 3.01 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|