C21H18F3N3O3 — CID 108823087
ethyl 4-[[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]methyl]benzoate (PubChem CID 108823087) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is ethyl 4-[[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 108823087 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | ethyl 4-[[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN/C=C(/C#N)C(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3N3O3/c1-2-30-20(29)15-9-7-14(8-10-15)12-26-13-16(11-25)19(28)27-18-6-4-3-5-17(18)21(22,23)24/h3-10,13,26H,2,12H2,1H3,(H,27,28)/b16-13- |
| InChIKey | YFRUIGSLMIYJME-SSZFMOIBSA-N |
| XLogP | 4.02 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|