C14H11F3N4O — CID 108823121
(Z)-2-cyano-3-(2-cyanoethylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108823121) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-cyanoethylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108823121 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CCCN/C=C(/C#N)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H11F3N4O/c15-14(16,17)11-4-1-2-5-12(11)21-13(22)10(8-19)9-20-7-3-6-18/h1-2,4-5,9,20H,3,7H2,(H,21,22)/b10-9- |
| InChIKey | WFLJKHHDDJUPDM-KTKRTIGZSA-N |
| XLogP | 2.55 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|