C18H13F3N4O2 — CID 108822992
2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]benzamide (PubChem CID 108822992) has the molecular formula C18H13F3N4O2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]benzamide.
| Compound Name | 2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]benzamide |
|---|---|
| PubChem CID | 108822992 |
| Molecular Formula | C18H13F3N4O2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]benzamide |
| SMILES | N#C/C(=C/Nc1ccccc1C(N)=O)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N4O2/c19-18(20,21)13-6-2-4-8-15(13)25-17(27)11(9-22)10-24-14-7-3-1-5-12(14)16(23)26/h1-8,10,24H,(H2,23,26)(H,25,27)/b11-10- |
| InChIKey | CMYHUTWSMGQVPD-KHPPLWFESA-N |
| XLogP | 3.26 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|