C18H21F3N4O3 — CID 108823129
tert-butyl N-[2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]ethyl]carbamate (PubChem CID 108823129) has the molecular formula C18H21F3N4O3 and a molecular weight of 398.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108823129 |
| Molecular Formula | C18H21F3N4O3 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl N-[2-[[(Z)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN/C=C(/C#N)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O3/c1-17(2,3)28-16(27)24-9-8-23-11-12(10-22)15(26)25-14-7-5-4-6-13(14)18(19,20)21/h4-7,11,23H,8-9H2,1-3H3,(H,24,27)(H,25,26)/b12-11- |
| InChIKey | YXFDTHBNSBTSDM-QXMHVHEDSA-N |
| XLogP | 3.17 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|