C17H22ClN5O3 — CID 108859938
tert-butyl N-[2-[[(Z)-3-(4-amino-2-chloroanilino)-2-cyano-3-oxoprop-1-enyl]amino]ethyl]carbamate (PubChem CID 108859938) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is tert-butyl N-[2-[[(Z)-3-(4-amino-2-chloroanilino)-2-cyano-3-oxoprop-1-enyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(Z)-3-(4-amino-2-chloroanilino)-2-cyano-3-oxoprop-1-enyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108859938 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl N-[2-[[(Z)-3-(4-amino-2-chloroanilino)-2-cyano-3-oxoprop-1-enyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN/C=C(/C#N)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H22ClN5O3/c1-17(2,3)26-16(25)22-7-6-21-10-11(9-19)15(24)23-14-5-4-12(20)8-13(14)18/h4-5,8,10,21H,6-7,20H2,1-3H3,(H,22,25)(H,23,24)/b11-10- |
| InChIKey | JOMDDEAJBDIIIG-KHPPLWFESA-N |
| XLogP | 2.38 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|