C15H19ClN4O2 — CID 108859589
(Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-(5-hydroxypentylamino)prop-2-enamide (PubChem CID 108859589) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-(5-hydroxypentylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-(5-hydroxypentylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108859589 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-(5-hydroxypentylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCCCCCO)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C15H19ClN4O2/c16-13-8-12(18)4-5-14(13)20-15(22)11(9-17)10-19-6-2-1-3-7-21/h4-5,8,10,19,21H,1-3,6-7,18H2,(H,20,22)/b11-10- |
| InChIKey | DTRYCIMYYXTHLG-KHPPLWFESA-N |
| XLogP | 2.02 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|