C23H24F3N3O3 — CID 108822996
(Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108822996) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108822996 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(CCN/C=C(/C#N)C(=O)Nc2ccccc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C23H24F3N3O3/c1-3-31-20-10-9-16(13-21(20)32-4-2)11-12-28-15-17(14-27)22(30)29-19-8-6-5-7-18(19)23(24,25)26/h5-10,13,15,28H,3-4,11-12H2,1-2H3,(H,29,30)/b17-15- |
| InChIKey | OONGXAAKBBMUKZ-ICFOKQHNSA-N |
| XLogP | 4.68 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|