C21H20F3N3O3 — CID 108836161
(Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)anilino]prop-2-enamide (PubChem CID 108836161) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108836161 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)anilino]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2ccccc2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C21H20F3N3O3/c1-29-18-8-7-14(11-19(18)30-2)9-10-26-20(28)15(12-25)13-27-17-6-4-3-5-16(17)21(22,23)24/h3-8,11,13,27H,9-10H2,1-2H3,(H,26,28)/b15-13- |
| InChIKey | BRKCMFBVTSMOMW-SQFISAMPSA-N |
| XLogP | 3.90 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|