C19H16N4OS — CID 108857325
(Z)-2-cyano-3-(2-cyanoethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857325) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-cyanoethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857325 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#CCCN/C=C(/C#N)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H16N4OS/c20-11-6-12-22-14-15(13-21)19(24)23-17-9-4-5-10-18(17)25-16-7-2-1-3-8-16/h1-5,7-10,14,22H,6,12H2,(H,23,24)/b15-14- |
| InChIKey | PZJKCXBWHARZDR-PFONDFGASA-N |
| XLogP | 3.69 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|