C23H16F3N3OS — CID 108857280
(Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-[4-(trifluoromethyl)anilino]prop-2-enamide (PubChem CID 108857280) has the molecular formula C23H16F3N3OS and a molecular weight of 439.46 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-[4-(trifluoromethyl)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-[4-(trifluoromethyl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108857280 |
| Molecular Formula | C23H16F3N3OS |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (Z)-2-cyano-N-(2-phenylsulfanylphenyl)-3-[4-(trifluoromethyl)anilino]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C23H16F3N3OS/c24-23(25,26)17-10-12-18(13-11-17)28-15-16(14-27)22(30)29-20-8-4-5-9-21(20)31-19-6-2-1-3-7-19/h1-13,15,28H,(H,29,30)/b16-15- |
| InChIKey | QVXIUGGSIQJCCY-NXVVXOECSA-N |
| XLogP | 6.31 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|