C22H16IN3OS — CID 108857244
(Z)-2-cyano-3-(4-iodoanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857244) has the molecular formula C22H16IN3OS and a molecular weight of 497.36 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-iodoanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-iodoanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857244 |
| Molecular Formula | C22H16IN3OS |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | (Z)-2-cyano-3-(4-iodoanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(I)cc1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C22H16IN3OS/c23-17-10-12-18(13-11-17)25-15-16(14-24)22(27)26-20-8-4-5-9-21(20)28-19-6-2-1-3-7-19/h1-13,15,25H,(H,26,27)/b16-15- |
| InChIKey | FUPBSJNUXNIDCH-NXVVXOECSA-N |
| XLogP | 5.90 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|