C22H15Cl2N3OS — CID 108821753
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide (PubChem CID 108821753) has the molecular formula C22H15Cl2N3OS and a molecular weight of 440.36 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108821753 |
| Molecular Formula | C22H15Cl2N3OS |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1Sc1ccccc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl2N3OS/c23-18-11-10-16(12-19(18)24)27-22(28)15(13-25)14-26-20-8-4-5-9-21(20)29-17-6-2-1-3-7-17/h1-12,14,26H,(H,27,28)/b15-14- |
| InChIKey | PRBKKYXVXFKQIN-PFONDFGASA-N |
| XLogP | 6.60 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|