C23H19N3O2S — CID 108828462
(Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide (PubChem CID 108828462) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108828462 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-phenylsulfanylanilino)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\Nc2ccccc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-28-19-13-11-18(12-14-19)26-23(27)17(15-24)16-25-21-9-5-6-10-22(21)29-20-7-3-2-4-8-20/h2-14,16,25H,1H3,(H,26,27)/b17-16- |
| InChIKey | MFLXKXKNVOPCCL-MSUUIHNZSA-N |
| XLogP | 5.30 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|