C23H17N3O3S — CID 108823245
4-[[(Z)-2-cyano-3-(2-phenylsulfanylanilino)prop-2-enoyl]amino]benzoic acid (PubChem CID 108823245) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(2-phenylsulfanylanilino)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(2-phenylsulfanylanilino)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823245 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(2-phenylsulfanylanilino)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1ccccc1Sc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H17N3O3S/c24-14-17(22(27)26-18-12-10-16(11-13-18)23(28)29)15-25-20-8-4-5-9-21(20)30-19-6-2-1-3-7-19/h1-13,15,25H,(H,26,27)(H,28,29)/b17-15- |
| InChIKey | UCNWAJAKUTYKOC-ICFOKQHNSA-N |
| XLogP | 4.99 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|