C23H18N4O3 — CID 108823324
4-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 108823324) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823324 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1ccc(Nc2ccccc2)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H18N4O3/c24-14-17(22(28)27-21-8-6-16(7-9-21)23(29)30)15-25-18-10-12-20(13-11-18)26-19-4-2-1-3-5-19/h1-13,15,25-26H,(H,27,28)(H,29,30)/b17-15- |
| InChIKey | XWYALOASSIVGIK-ICFOKQHNSA-N |
| XLogP | 4.59 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|