C26H26N4O — CID 108828170
(Z)-3-(4-anilinoanilino)-N-(4-butylphenyl)-2-cyanoprop-2-enamide (PubChem CID 108828170) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is (Z)-3-(4-anilinoanilino)-N-(4-butylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(4-anilinoanilino)-N-(4-butylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108828170 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (Z)-3-(4-anilinoanilino)-N-(4-butylphenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O/c1-2-3-7-20-10-12-25(13-11-20)30-26(31)21(18-27)19-28-22-14-16-24(17-15-22)29-23-8-5-4-6-9-23/h4-6,8-17,19,28-29H,2-3,7H2,1H3,(H,30,31)/b21-19- |
| InChIKey | YYFHRNDGWMQTTP-VZCXRCSSSA-N |
| XLogP | 6.23 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|