C24H23N3O — CID 108828196
(Z)-N-(4-butylphenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide (PubChem CID 108828196) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (Z)-N-(4-butylphenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108828196 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N3O/c1-2-3-7-18-12-14-21(15-13-18)27-24(28)20(16-25)17-26-23-11-6-9-19-8-4-5-10-22(19)23/h4-6,8-15,17,26H,2-3,7H2,1H3,(H,27,28)/b20-17- |
| InChIKey | JIFTXDWGXAGWIW-JZJYNLBNSA-N |
| XLogP | 5.64 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|