C22H22N2O2 — CID 108502463
N-(4-butylphenyl)-N'-naphthalen-1-yloxamide (PubChem CID 108502463) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(4-butylphenyl)-N'-naphthalen-1-yloxamide.
| Compound Name | N-(4-butylphenyl)-N'-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 108502463 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(4-butylphenyl)-N'-naphthalen-1-yloxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-2-3-7-16-12-14-18(15-13-16)23-21(25)22(26)24-20-11-6-9-17-8-4-5-10-19(17)20/h4-6,8-15H,2-3,7H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | IXNNMRTXXNMAGY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|