C23H27N3O — CID 108828074
(Z)-N-(4-butylphenyl)-2-cyano-3-(2-ethyl-6-methylanilino)prop-2-enamide (PubChem CID 108828074) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (Z)-N-(4-butylphenyl)-2-cyano-3-(2-ethyl-6-methylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(2-ethyl-6-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108828074 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(2-ethyl-6-methylanilino)prop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2c(C)cccc2CC)cc1 |
| InChI | InChI=1S/C23H27N3O/c1-4-6-9-18-11-13-21(14-12-18)26-23(27)20(15-24)16-25-22-17(3)8-7-10-19(22)5-2/h7-8,10-14,16,25H,4-6,9H2,1-3H3,(H,26,27)/b20-16- |
| InChIKey | UUUXECVJFSSKQB-SILNSSARSA-N |
| XLogP | 5.36 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|