C22H15F2N3OS — CID 108857281
(Z)-2-cyano-3-(2,4-difluoroanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857281) has the molecular formula C22H15F2N3OS and a molecular weight of 407.45 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857281 |
| Molecular Formula | C22H15F2N3OS |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(F)cc1F)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C22H15F2N3OS/c23-16-10-11-19(18(24)12-16)26-14-15(13-25)22(28)27-20-8-4-5-9-21(20)29-17-6-2-1-3-7-17/h1-12,14,26H,(H,27,28)/b15-14- |
| InChIKey | KDSDVOJAAAZFNQ-PFONDFGASA-N |
| XLogP | 5.57 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|