C20H13F2N3O2 — CID 108843121
(Z)-2-cyano-3-(2,4-difluoroanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide (PubChem CID 108843121) has the molecular formula C20H13F2N3O2 and a molecular weight of 365.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108843121 |
| Molecular Formula | C20H13F2N3O2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (Z)-2-cyano-3-(2,4-difluoroanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(F)cc1F)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C20H13F2N3O2/c21-13-7-8-18(16(22)9-13)24-11-12(10-23)20(27)25-17-5-1-4-15-14(17)3-2-6-19(15)26/h1-9,11,24,26H,(H,25,27)/b12-11- |
| InChIKey | HIJNCNWXXFGKAX-QXMHVHEDSA-N |
| XLogP | 4.28 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|