C18H13N5O2 — CID 108842954
(Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108842954) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108842954 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (Z)-2-cyano-N-(5-hydroxynaphthalen-1-yl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncccn1)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C18H13N5O2/c19-10-12(11-22-18-20-8-3-9-21-18)17(25)23-15-6-1-5-14-13(15)4-2-7-16(14)24/h1-9,11,24H,(H,23,25)(H,20,21,22)/b12-11- |
| InChIKey | HQUDGTSXWSSEJT-QXMHVHEDSA-N |
| XLogP | 2.79 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|